C29H36O13 — CID 163049997
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,9R,10R)-2,10-dimethyl-4,11-dioxo-12-oxatricyclo[7.3.1.01,5]trideca-2,5-dien-6-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 163049997) has the molecular formula C29H36O13 and a molecular weight of 592.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,9R,10R)-2,10-dimethyl-4,11-dioxo-12-oxatricyclo[7.3.1.01,5]trideca-2,5-dien-6-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,9R,10R)-2,10-dimethyl-4,11-dioxo-12-oxatricyclo[7.3.1.01,5]trideca-2,5-dien-6-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163049997 |
| Molecular Formula | C29H36O13 |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,9R,10R)-2,10-dimethyl-4,11-dioxo-12-oxatricyclo[7.3.1.01,5]trideca-2,5-dien-6-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCC2=C3C(=O)C=C(C)[C@@]34C[C@@H](CC2)[C@@H](C)C(=O)O4)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H36O13/c1-13-9-21(34)23-20(8-7-19-10-29(13,23)42-27(35)14(19)2)11-37-28-26(40-18(6)33)25(39-17(5)32)24(38-16(4)31)22(41-28)12-36-15(3)30/h9,14,19,22,24-26,28H,7-8,10-12H2,1-6H3/t14-,19-,22-,24-,25+,26-,28-,29+/m1/s1 |
| InChIKey | GUKVRBVITJAFHG-UFTWWUHJSA-N |
| XLogP | 1.64 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|