C29H42O5 — CID 163050090
(1S,3'R,4aS,7aS)-3-[4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-2',2',4a,7a-tetramethylspiro[6,7-dihydro-5H-cyclopenta[c]pyran-1,5'-oxolane]-3'-ol (PubChem CID 163050090) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is (1S,3'R,4aS,7aS)-3-[4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-2',2',4a,7a-tetramethylspiro[6,7-dihydro-5H-cyclopenta[c]pyran-1,5'-oxolane]-3'-ol.
| Compound Name | (1S,3'R,4aS,7aS)-3-[4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-2',2',4a,7a-tetramethylspiro[6,7-dihydro-5H-cyclopenta[c]pyran-1,5'-oxolane]-3'-ol |
|---|---|
| PubChem CID | 163050090 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (1S,3'R,4aS,7aS)-3-[4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-2',2',4a,7a-tetramethylspiro[6,7-dihydro-5H-cyclopenta[c]pyran-1,5'-oxolane]-3'-ol |
| SMILES | COc1cc(C)c(OC)c(CC=C(C)CC2=C[C@]3(C)CCC[C@]3(C)[C@@]3(C[C@@H](O)C(C)(C)O3)O2)c1 |
| InChI | InChI=1S/C29H42O5/c1-19(10-11-21-16-22(31-7)15-20(2)25(21)32-8)14-23-17-27(5)12-9-13-28(27,6)29(33-23)18-24(30)26(3,4)34-29/h10,15-17,24,30H,9,11-14,18H2,1-8H3/t24-,27+,28+,29+/m1/s1 |
| InChIKey | LMSRXHXSWMRYEX-KHUDPXOFSA-N |
| XLogP | 6.26 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|