C20H32O6 — CID 163050130
4-methoxy-2-(2,4,8-trihydroxy-3,7,9-trimethylundeca-5,9-dienyl)-2,3-dihydropyran-6-one (PubChem CID 163050130) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-methoxy-2-(2,4,8-trihydroxy-3,7,9-trimethylundeca-5,9-dienyl)-2,3-dihydropyran-6-one.
| Compound Name | 4-methoxy-2-(2,4,8-trihydroxy-3,7,9-trimethylundeca-5,9-dienyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 163050130 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 4-methoxy-2-(2,4,8-trihydroxy-3,7,9-trimethylundeca-5,9-dienyl)-2,3-dihydropyran-6-one |
| SMILES | CC=C(C)C(O)C(C)C=CC(O)C(C)C(O)CC1CC(OC)=CC(=O)O1 |
| InChI | InChI=1S/C20H32O6/c1-6-12(2)20(24)13(3)7-8-17(21)14(4)18(22)10-16-9-15(25-5)11-19(23)26-16/h6-8,11,13-14,16-18,20-22,24H,9-10H2,1-5H3 |
| InChIKey | ZSCSHJBZNPXUQJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|