(E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid

C9H16O4 — CID 163050810

IUPAC(E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid
SMILESC/C=C/[C@@H](O)[C@@H](C)[C@H](O)CC(=O)O
InChIInChI=1S/C9H16O4/c1-3-4-7(10)6(2)8(11)5-9(12)13/h3-4,6-8,10-11H,5H2,1-2H3,(H,12,13)/b4-3+/t6-,7-,8-/m1/s1
InChIKeyBURGXDFWYUVAGQ-DBCCTYIESA-N
MW188.22 g/mol
LogP0.40
Rot. Bonds5

About (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid

(E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid (PubChem CID 163050810) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid.

Molecular Properties

Compound Name(E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid
PubChem CID163050810
Molecular FormulaC9H16O4
Molecular Weight188.22 g/mol
Exact Mass188.10
IUPAC Name(E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid
SMILESC/C=C/[C@@H](O)[C@@H](C)[C@H](O)CC(=O)O
InChIInChI=1S/C9H16O4/c1-3-4-7(10)6(2)8(11)5-9(12)13/h3-4,6-8,10-11H,5H2,1-2H3,(H,12,13)/b4-3+/t6-,7-,8-/m1/s1
InChIKeyBURGXDFWYUVAGQ-DBCCTYIESA-N
XLogP0.40
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.22
LogP ≤ 50.40
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid?
The IUPAC name of (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid (CID 163050810) is (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid.
What is the SMILES notation for (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid?
The canonical SMILES for (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid is C/C=C/[C@@H](O)[C@@H](C)[C@H](O)CC(=O)O.
What is the InChIKey of (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid?
The InChIKey is BURGXDFWYUVAGQ-DBCCTYIESA-N. The full InChI is InChI=1S/C9H16O4/c1-3-4-7(10)6(2)8(11)5-9(12)13/h3-4,6-8,10-11H,5H2,1-2H3,(H,12,13)/b4-3+/t6-,7-,8-/m1/s1.
What are the key properties of (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid?
(E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid has a molecular weight of 188.22 g/mol, XLogP of 0.40, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3R,4S,5R)-3,5-dihydroxy-4-methyloct-6-enoic acid is sourced from PubChem (CID 163050810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).