C32H46O6 — CID 163051242
6'-ethyl-9-hydroxy-5',6,10,14,16-pentamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3,7-dione (PubChem CID 163051242) has the molecular formula C32H46O6 and a molecular weight of 526.71 g/mol. Its IUPAC name is 6'-ethyl-9-hydroxy-5',6,10,14,16-pentamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3,7-dione.
| Compound Name | 6'-ethyl-9-hydroxy-5',6,10,14,16-pentamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3,7-dione |
|---|---|
| PubChem CID | 163051242 |
| Molecular Formula | C32H46O6 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 6'-ethyl-9-hydroxy-5',6,10,14,16-pentamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3,7-dione |
| SMILES | CCC1OC2(CCC1C)CC1CC(CC=C(C)CC(C)C=CC=C(C)C3(O)CC(=O)C(C)=CC3C(=O)O1)O2 |
| InChI | InChI=1S/C32H46O6/c1-7-29-22(4)13-14-31(38-29)18-26-17-25(37-31)12-11-21(3)15-20(2)9-8-10-24(6)32(35)19-28(33)23(5)16-27(32)30(34)36-26/h8-11,16,20,22,25-27,29,35H,7,12-15,17-19H2,1-6H3 |
| InChIKey | VPZCPXVSRRYBQC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|