C25H36O6 — CID 163051577
[3-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-methylbut-2-enoate (PubChem CID 163051577) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is [3-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-methylbut-2-enoate.
| Compound Name | [3-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163051577 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [3-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-methylbut-2-enoate |
| SMILES | C=C1CCC2C(C)(CC(O)C(OC(=O)C(C)=CC)C2(C)CO)C1CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C25H36O6/c1-6-15(2)23(29)31-22-19(27)12-24(4)18(9-8-17-11-21(28)30-13-17)16(3)7-10-20(24)25(22,5)14-26/h6,11,18-20,22,26-27H,3,7-10,12-14H2,1-2,4-5H3 |
| InChIKey | URUJNQASZVVYAZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|