C27H32O7 — CID 163051764
(1S,2S,7S,10S)-1,7-dihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-diene-5,16-dione (PubChem CID 163051764) has the molecular formula C27H32O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is (1S,2S,7S,10S)-1,7-dihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-diene-5,16-dione.
| Compound Name | (1S,2S,7S,10S)-1,7-dihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-diene-5,16-dione |
|---|---|
| PubChem CID | 163051764 |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (1S,2S,7S,10S)-1,7-dihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-diene-5,16-dione |
| SMILES | COc1ccc(-c2cc3c(c(=O)o2)C[C@]2(O)[C@@]4(C)CCC(=O)C(C)(C)[C@]4(O)CC[C@]2(C)O3)cc1 |
| InChI | InChI=1S/C27H32O7/c1-23(2)21(28)10-11-24(3)26(23,30)13-12-25(4)27(24,31)15-18-20(34-25)14-19(33-22(18)29)16-6-8-17(32-5)9-7-16/h6-9,14,30-31H,10-13,15H2,1-5H3/t24-,25-,26+,27-/m0/s1 |
| InChIKey | ARZWKYJFXLHKCZ-NFGXINMFSA-N |
| XLogP | 3.66 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |