C28H44N2O — CID 163052510
(1R,2R,3S,9Z,18S,25E,29R)-5,20-diazapentacyclo[14.12.1.11,5.02,18.020,29]triaconta-9,16,25-trien-3-ol (PubChem CID 163052510) has the molecular formula C28H44N2O and a molecular weight of 424.67 g/mol. Its IUPAC name is (1R,2R,3S,9Z,18S,25E,29R)-5,20-diazapentacyclo[14.12.1.11,5.02,18.020,29]triaconta-9,16,25-trien-3-ol.
| Compound Name | (1R,2R,3S,9Z,18S,25E,29R)-5,20-diazapentacyclo[14.12.1.11,5.02,18.020,29]triaconta-9,16,25-trien-3-ol |
|---|---|
| PubChem CID | 163052510 |
| Molecular Formula | C28H44N2O |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.35 |
| IUPAC Name | (1R,2R,3S,9Z,18S,25E,29R)-5,20-diazapentacyclo[14.12.1.11,5.02,18.020,29]triaconta-9,16,25-trien-3-ol |
| SMILES | O[C@@H]1CN2CCC/C=C\CCCCCC3=C[C@@H]4CN5CCCC/C=C\CC[C@](C2)([C@H]14)[C@@H]35 |
| InChI | InChI=1S/C28H44N2O/c31-25-21-29-17-13-9-5-2-1-3-7-11-15-23-19-24-20-30-18-14-10-6-4-8-12-16-28(22-29,26(24)25)27(23)30/h2,4-5,8,19,24-27,31H,1,3,6-7,9-18,20-22H2/b5-2-,8-4-/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | SVFQETJDDGVUQV-WMFRXSFNSA-N |
| XLogP | 5.33 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|