C15H14O4 — CID 163052667
(2R,3R,3aR,9aR)-3-hydroxy-2-prop-1-en-2-yl-2,3,3a,9a-tetrahydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 163052667) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is (2R,3R,3aR,9aR)-3-hydroxy-2-prop-1-en-2-yl-2,3,3a,9a-tetrahydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | (2R,3R,3aR,9aR)-3-hydroxy-2-prop-1-en-2-yl-2,3,3a,9a-tetrahydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 163052667 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (2R,3R,3aR,9aR)-3-hydroxy-2-prop-1-en-2-yl-2,3,3a,9a-tetrahydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | C=C(C)[C@H]1O[C@H]2C(=O)c3ccccc3C(=O)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C15H14O4/c1-7(2)14-13(18)10-11(16)8-5-3-4-6-9(8)12(17)15(10)19-14/h3-6,10,13-15,18H,1H2,2H3/t10-,13-,14-,15-/m1/s1 |
| InChIKey | UJFPBIAXTXQMNB-JUDXGUMMSA-N |
| XLogP | 1.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|