C33H57NO13 — CID 163053807
6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-5,14-dihydroxy-8-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5,7,13,15-tetramethyl-1,11-dioxaspiro[2.13]hexadecane-10,16-dione (PubChem CID 163053807) has the molecular formula C33H57NO13 and a molecular weight of 675.81 g/mol. Its IUPAC name is 6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-5,14-dihydroxy-8-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5,7,13,15-tetramethyl-1,11-dioxaspiro[2.13]hexadecane-10,16-dione.
| Compound Name | 6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-5,14-dihydroxy-8-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5,7,13,15-tetramethyl-1,11-dioxaspiro[2.13]hexadecane-10,16-dione |
|---|---|
| PubChem CID | 163053807 |
| Molecular Formula | C33H57NO13 |
| Molecular Weight | 675.81 g/mol |
| Exact Mass | 675.38 |
| IUPAC Name | 6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-5,14-dihydroxy-8-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5,7,13,15-tetramethyl-1,11-dioxaspiro[2.13]hexadecane-10,16-dione |
| SMILES | COC1CC(OC2CC(=O)OCC(C)C(O)C(C)C(=O)C3(CO3)CC(C)(O)C(OC3OC(C)CC(N(C)C)C3O)C2C)OC(C)C1O |
| InChI | InChI=1S/C33H57NO13/c1-16-13-42-24(35)11-22(46-25-12-23(41-9)27(37)20(5)45-25)18(3)30(47-31-28(38)21(34(7)8)10-17(2)44-31)32(6,40)14-33(15-43-33)29(39)19(4)26(16)36/h16-23,25-28,30-31,36-38,40H,10-15H2,1-9H3 |
| InChIKey | ABUBEWDQRGAYOA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 186.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.81 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|