C24H34O9 — CID 163054160
[(1S,2R,3S,4R,7S,8Z,12S,13S,14S,16S,18R)-14-acetyloxy-2,3-dihydroxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] acetate (PubChem CID 163054160) has the molecular formula C24H34O9 and a molecular weight of 466.53 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,16S,18R)-14-acetyloxy-2,3-dihydroxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] acetate.
| Compound Name | [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,16S,18R)-14-acetyloxy-2,3-dihydroxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] acetate |
|---|---|
| PubChem CID | 163054160 |
| Molecular Formula | C24H34O9 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,16S,18R)-14-acetyloxy-2,3-dihydroxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC/C(C)=C\[C@@H]2OC(=O)[C@H](C)[C@]2(O)[C@H](O)[C@H]2[C@@]3(C)O[C@H]3C[C@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C24H34O9/c1-11-7-8-15(30-13(3)25)22(5)16(31-14(4)26)10-17-23(6,33-17)19(22)20(27)24(29)12(2)21(28)32-18(24)9-11/h9,12,15-20,27,29H,7-8,10H2,1-6H3/b11-9-/t12-,15-,16-,17-,18-,19+,20+,22-,23-,24+/m0/s1 |
| InChIKey | QGRHFZHVNPHIGN-KMDYMMOESA-N |
| XLogP | 1.43 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|