C17H26O2 — CID 163054375
(3R,4aS,6aR,10aS,10bS)-3-ethyl-5,10b-dimethyl-4,4a,6a,7,8,9,10,10a-octahydro-3H-benzo[h]isochromen-1-one (PubChem CID 163054375) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (3R,4aS,6aR,10aS,10bS)-3-ethyl-5,10b-dimethyl-4,4a,6a,7,8,9,10,10a-octahydro-3H-benzo[h]isochromen-1-one.
| Compound Name | (3R,4aS,6aR,10aS,10bS)-3-ethyl-5,10b-dimethyl-4,4a,6a,7,8,9,10,10a-octahydro-3H-benzo[h]isochromen-1-one |
|---|---|
| PubChem CID | 163054375 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (3R,4aS,6aR,10aS,10bS)-3-ethyl-5,10b-dimethyl-4,4a,6a,7,8,9,10,10a-octahydro-3H-benzo[h]isochromen-1-one |
| SMILES | CC[C@@H]1C[C@H]2C(C)=C[C@H]3CCCC[C@@H]3[C@]2(C)C(=O)O1 |
| InChI | InChI=1S/C17H26O2/c1-4-13-10-15-11(2)9-12-7-5-6-8-14(12)17(15,3)16(18)19-13/h9,12-15H,4-8,10H2,1-3H3/t12-,13-,14+,15+,17+/m1/s1 |
| InChIKey | DOVJKETUGTWKML-KDEOKCCVSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|