C24H32N2O9 — CID 163054487
[8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 163054487) has the molecular formula C24H32N2O9 and a molecular weight of 492.53 g/mol. Its IUPAC name is [8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163054487 |
| Molecular Formula | C24H32N2O9 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [8-butyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CCCCC1C(=O)OCC(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)C(C)C |
| InChI | InChI=1S/C24H32N2O9/c1-5-6-8-16-20(35-22(30)13(2)3)14(4)34-24(32)18(11-33-23(16)31)26-21(29)15-9-7-10-17(19(15)28)25-12-27/h7,9-10,12-14,16,18,20,28H,5-6,8,11H2,1-4H3,(H,25,27)(H,26,29) |
| InChIKey | GPVOROYREUFGAB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|