C48H91N3O13 — CID 163056325
2-[5-(33-butyl-10,12,14,16,18,19,22,24,28,32-decahydroxy-3,5,21,31-tetramethyl-34-oxo-1-oxacyclotetratriaconta-4,20-dien-2-yl)-4-hydroxyhexyl]guanidine (PubChem CID 163056325) has the molecular formula C48H91N3O13 and a molecular weight of 918.26 g/mol. Its IUPAC name is 2-[5-(33-butyl-10,12,14,16,18,19,22,24,28,32-decahydroxy-3,5,21,31-tetramethyl-34-oxo-1-oxacyclotetratriaconta-4,20-dien-2-yl)-4-hydroxyhexyl]guanidine.
| Compound Name | 2-[5-(33-butyl-10,12,14,16,18,19,22,24,28,32-decahydroxy-3,5,21,31-tetramethyl-34-oxo-1-oxacyclotetratriaconta-4,20-dien-2-yl)-4-hydroxyhexyl]guanidine |
|---|---|
| PubChem CID | 163056325 |
| Molecular Formula | C48H91N3O13 |
| Molecular Weight | 918.26 g/mol |
| Exact Mass | 917.66 |
| IUPAC Name | 2-[5-(33-butyl-10,12,14,16,18,19,22,24,28,32-decahydroxy-3,5,21,31-tetramethyl-34-oxo-1-oxacyclotetratriaconta-4,20-dien-2-yl)-4-hydroxyhexyl]guanidine |
| SMILES | CCCCC1C(=O)OC(C(C)C(O)CCCN=C(N)N)C(C)C=C(C)CCCCC(O)CC(O)CC(O)CC(O)CC(O)C(O)C=C(C)C(O)CC(O)CCCC(O)CCC(C)C1O |
| InChI | InChI=1S/C48H91N3O13/c1-7-8-17-40-45(62)30(3)19-20-34(52)15-11-16-36(54)27-42(59)31(4)23-43(60)44(61)28-39(57)26-38(56)25-37(55)24-35(53)14-10-9-13-29(2)22-32(5)46(64-47(40)63)33(6)41(58)18-12-21-51-48(49)50/h22-23,30,32-46,52-62H,7-21,24-28H2,1-6H3,(H4,49,50,51) |
| InChIKey | DZHBSACGXURSOI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 313.23 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|