C36H66O8 — CID 163056640
6,13,24,31-tetrahydroxyhexatriacontane-8,15,22,29-tetrone (PubChem CID 163056640) has the molecular formula C36H66O8 and a molecular weight of 626.92 g/mol. Its IUPAC name is 6,13,24,31-tetrahydroxyhexatriacontane-8,15,22,29-tetrone.
| Compound Name | 6,13,24,31-tetrahydroxyhexatriacontane-8,15,22,29-tetrone |
|---|---|
| PubChem CID | 163056640 |
| Molecular Formula | C36H66O8 |
| Molecular Weight | 626.92 g/mol |
| Exact Mass | 626.48 |
| IUPAC Name | 6,13,24,31-tetrahydroxyhexatriacontane-8,15,22,29-tetrone |
| SMILES | CCCCCC(O)CC(=O)CCCCC(O)CC(=O)CCCCCCC(=O)CC(O)CCCCC(=O)CC(O)CCCCC |
| InChI | InChI=1S/C36H66O8/c1-3-5-9-17-29(37)25-33(41)21-13-15-23-35(43)27-31(39)19-11-7-8-12-20-32(40)28-36(44)24-16-14-22-34(42)26-30(38)18-10-6-4-2/h29-30,35-38,43-44H,3-28H2,1-2H3 |
| InChIKey | OQNUEGRNUAWICA-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.92 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|