C32H48O5 — CID 163056862
(2R,3S)-2-[(1E,3Z,5R,7Z,9Z,11S,13S,14R,15S,17Z)-14,19-dihydroxy-3,5,9,11,13,15,17-heptamethyl-12-oxononadeca-1,3,7,9,17-pentaenyl]-3-methyl-2,3-dihydropyran-6-one (PubChem CID 163056862) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is (2R,3S)-2-[(1E,3Z,5R,7Z,9Z,11S,13S,14R,15S,17Z)-14,19-dihydroxy-3,5,9,11,13,15,17-heptamethyl-12-oxononadeca-1,3,7,9,17-pentaenyl]-3-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2R,3S)-2-[(1E,3Z,5R,7Z,9Z,11S,13S,14R,15S,17Z)-14,19-dihydroxy-3,5,9,11,13,15,17-heptamethyl-12-oxononadeca-1,3,7,9,17-pentaenyl]-3-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 163056862 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | (2R,3S)-2-[(1E,3Z,5R,7Z,9Z,11S,13S,14R,15S,17Z)-14,19-dihydroxy-3,5,9,11,13,15,17-heptamethyl-12-oxononadeca-1,3,7,9,17-pentaenyl]-3-methyl-2,3-dihydropyran-6-one |
| SMILES | CC(/C=C\C[C@@H](C)/C=C(C)\C=C\[C@H]1OC(=O)C=C[C@@H]1C)=C/[C@H](C)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C\CO |
| InChI | InChI=1S/C32H48O5/c1-21(18-23(3)12-14-29-25(5)13-15-30(34)37-29)10-9-11-22(2)19-26(6)31(35)28(8)32(36)27(7)20-24(4)16-17-33/h9,11-16,18-19,21,25-29,32-33,36H,10,17,20H2,1-8H3/b11-9-,14-12+,22-19-,23-18-,24-16-/t21-,25+,26+,27+,28-,29-,32-/m1/s1 |
| InChIKey | LMXMVUQKOHQTKA-HHCDPYKWSA-N |
| XLogP | 6.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|