About 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol
6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol (PubChem CID 163057718) has the molecular formula C17H29N3O4
and a molecular weight of 339.44 g/mol. Its IUPAC name is 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol.
Molecular Properties
| Compound Name | 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol |
| PubChem CID | 163057718 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol |
| SMILES | COCc1cc(CC2CCC(O)C(CNC3CCNCC3)O2)no1 |
| InChI | InChI=1S/C17H29N3O4/c1-22-11-15-9-13(20-24-15)8-14-2-3-16(21)17(23-14)10-19-12-4-6-18-7-5-12/h9,12,14,16-19,21H,2-8,10-11H2,1H3 |
| InChIKey | VKUVUSCPSUVPLE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol?
The IUPAC name of 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol (CID 163057718) is 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol.
What is the SMILES notation for 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol?
The canonical SMILES for 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol is COCc1cc(CC2CCC(O)C(CNC3CCNCC3)O2)no1.
What is the InChIKey of 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol?
The InChIKey is VKUVUSCPSUVPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O4/c1-22-11-15-9-13(20-24-15)8-14-2-3-16(21)17(23-14)10-19-12-4-6-18-7-5-12/h9,12,14,16-19,21H,2-8,10-11H2,1H3.
What are the key properties of 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol?
6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol has a molecular weight of 339.44 g/mol, XLogP of 0.61, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-2-[(piperidin-4-ylamino)methyl]oxan-3-ol is sourced from PubChem (CID 163057718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).