C39H54O8 — CID 163057812
8,10-dihydroxy-2-(hydroxymethyl)-9-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-1,6a,6b,9,12a-pentamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid (PubChem CID 163057812) has the molecular formula C39H54O8 and a molecular weight of 650.85 g/mol. Its IUPAC name is 8,10-dihydroxy-2-(hydroxymethyl)-9-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-1,6a,6b,9,12a-pentamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | 8,10-dihydroxy-2-(hydroxymethyl)-9-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-1,6a,6b,9,12a-pentamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 163057812 |
| Molecular Formula | C39H54O8 |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.38 |
| IUPAC Name | 8,10-dihydroxy-2-(hydroxymethyl)-9-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-1,6a,6b,9,12a-pentamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| SMILES | CC1C(CO)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(COC(=O)C=Cc6ccc(O)cc6)C5C(O)CC43C)C12 |
| InChI | InChI=1S/C39H54O8/c1-23-25(21-40)14-17-39(34(45)46)19-18-37(4)27(32(23)39)11-12-29-35(2)16-15-30(43)36(3,33(35)28(42)20-38(29,37)5)22-47-31(44)13-8-24-6-9-26(41)10-7-24/h6-11,13,23,25,28-30,32-33,40-43H,12,14-22H2,1-5H3,(H,45,46) |
| InChIKey | UDVALQAMVNUBLE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|