C18H26O5 — CID 163058501
3-heptyl-6,8-dihydroxy-5-methyl-3,4-dihydro-1H-isochromene-7-carboxylic acid (PubChem CID 163058501) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-heptyl-6,8-dihydroxy-5-methyl-3,4-dihydro-1H-isochromene-7-carboxylic acid.
| Compound Name | 3-heptyl-6,8-dihydroxy-5-methyl-3,4-dihydro-1H-isochromene-7-carboxylic acid |
|---|---|
| PubChem CID | 163058501 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-heptyl-6,8-dihydroxy-5-methyl-3,4-dihydro-1H-isochromene-7-carboxylic acid |
| SMILES | CCCCCCCC1Cc2c(C)c(O)c(C(=O)O)c(O)c2CO1 |
| InChI | InChI=1S/C18H26O5/c1-3-4-5-6-7-8-12-9-13-11(2)16(19)15(18(21)22)17(20)14(13)10-23-12/h12,19-20H,3-10H2,1-2H3,(H,21,22) |
| InChIKey | SNWYHMYDWIFBON-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|