C31H50O5 — CID 163058797
7-(1,3-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyloct-3-ene-2,3,4-triol (PubChem CID 163058797) has the molecular formula C31H50O5 and a molecular weight of 502.74 g/mol. Its IUPAC name is 7-(1,3-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyloct-3-ene-2,3,4-triol.
| Compound Name | 7-(1,3-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyloct-3-ene-2,3,4-triol |
|---|---|
| PubChem CID | 163058797 |
| Molecular Formula | C31H50O5 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | 7-(1,3-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyloct-3-ene-2,3,4-triol |
| SMILES | CC(CCC(O)=C(O)C(C)(C)O)C1CCC2(C)C3=CCC4C(C)(C)C(O)CC(O)C4(C)C3=CCC12C |
| InChI | InChI=1S/C31H50O5/c1-18(9-11-22(32)26(35)28(4,5)36)19-13-15-30(7)20-10-12-23-27(2,3)24(33)17-25(34)31(23,8)21(20)14-16-29(19,30)6/h10,14,18-19,23-25,32-36H,9,11-13,15-17H2,1-8H3 |
| InChIKey | IUEVPODCPYPYFM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|