C21H33NO6 — CID 163059026
[(7S,8R)-7-[(Z)-2-methylbut-2-enoyl]oxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2R)-2,3-dihydroxy-3-methyl-2-propan-2-ylbutanoate (PubChem CID 163059026) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is [(7S,8R)-7-[(Z)-2-methylbut-2-enoyl]oxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2R)-2,3-dihydroxy-3-methyl-2-propan-2-ylbutanoate.
| Compound Name | [(7S,8R)-7-[(Z)-2-methylbut-2-enoyl]oxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2R)-2,3-dihydroxy-3-methyl-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 163059026 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | [(7S,8R)-7-[(Z)-2-methylbut-2-enoyl]oxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2R)-2,3-dihydroxy-3-methyl-2-propan-2-ylbutanoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1CCN2CC=C(COC(=O)[C@@](O)(C(C)C)C(C)(C)O)[C@H]12 |
| InChI | InChI=1S/C21H33NO6/c1-7-14(4)18(23)28-16-9-11-22-10-8-15(17(16)22)12-27-19(24)21(26,13(2)3)20(5,6)25/h7-8,13,16-17,25-26H,9-12H2,1-6H3/b14-7-/t16-,17+,21-/m0/s1 |
| InChIKey | YHPCSAOULAHGKY-MARZHUSPSA-N |
| XLogP | 1.58 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|