C38H50O9 — CID 163060060
6-[(1S)-1-[(9R)-1,3-dihydroxy-5,5,7,7-tetramethyl-4-(2-methylpropanoyl)-6,8-dioxo-9-propan-2-yl-9H-xanthen-2-yl]-2-methylpropyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 163060060) has the molecular formula C38H50O9 and a molecular weight of 650.81 g/mol. Its IUPAC name is 6-[(1S)-1-[(9R)-1,3-dihydroxy-5,5,7,7-tetramethyl-4-(2-methylpropanoyl)-6,8-dioxo-9-propan-2-yl-9H-xanthen-2-yl]-2-methylpropyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[(1S)-1-[(9R)-1,3-dihydroxy-5,5,7,7-tetramethyl-4-(2-methylpropanoyl)-6,8-dioxo-9-propan-2-yl-9H-xanthen-2-yl]-2-methylpropyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 163060060 |
| Molecular Formula | C38H50O9 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | 6-[(1S)-1-[(9R)-1,3-dihydroxy-5,5,7,7-tetramethyl-4-(2-methylpropanoyl)-6,8-dioxo-9-propan-2-yl-9H-xanthen-2-yl]-2-methylpropyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CC(C)C(=O)c1c(O)c([C@@H](C(C)C)C2C(=O)C(C)(C)C(=O)C(C)(C)C2=O)c(O)c2c1OC1=C(C(=O)C(C)(C)C(=O)C1(C)C)[C@@H]2C(C)C |
| InChI | InChI=1S/C38H50O9/c1-15(2)18(22-29(42)35(7,8)33(45)36(9,10)30(22)43)20-26(40)21-19(16(3)4)23-31(44)37(11,12)34(46)38(13,14)32(23)47-28(21)24(27(20)41)25(39)17(5)6/h15-19,22,40-41H,1-14H3/t18-,19-/m1/s1 |
| InChIKey | NMSNLAOCVMELEC-RTBURBONSA-N |
| XLogP | 6.66 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|