C21H36O — CID 163060601
(3aS,5R,8S,8aR)-8-methoxy-3,8-dimethyl-5-[(2R)-6-methylhept-5-en-2-yl]-3a,4,5,6,7,8a-hexahydro-1H-azulene (PubChem CID 163060601) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is (3aS,5R,8S,8aR)-8-methoxy-3,8-dimethyl-5-[(2R)-6-methylhept-5-en-2-yl]-3a,4,5,6,7,8a-hexahydro-1H-azulene.
| Compound Name | (3aS,5R,8S,8aR)-8-methoxy-3,8-dimethyl-5-[(2R)-6-methylhept-5-en-2-yl]-3a,4,5,6,7,8a-hexahydro-1H-azulene |
|---|---|
| PubChem CID | 163060601 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (3aS,5R,8S,8aR)-8-methoxy-3,8-dimethyl-5-[(2R)-6-methylhept-5-en-2-yl]-3a,4,5,6,7,8a-hexahydro-1H-azulene |
| SMILES | CO[C@@]1(C)CC[C@@H]([C@H](C)CCC=C(C)C)C[C@@H]2C(C)=CC[C@H]21 |
| InChI | InChI=1S/C21H36O/c1-15(2)8-7-9-16(3)18-12-13-21(5,22-6)20-11-10-17(4)19(20)14-18/h8,10,16,18-20H,7,9,11-14H2,1-6H3/t16-,18-,19-,20-,21+/m1/s1 |
| InChIKey | GZCIZEZRHGPZQL-MLZLACJZSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|