C17H21N3O4S — CID 163060626
methyl 4-methylsulfanyl-2-[3-(3-oxo-4H-quinoxalin-2-yl)propanoylamino]butanoate (PubChem CID 163060626) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-[3-(3-oxo-4H-quinoxalin-2-yl)propanoylamino]butanoate.
| Compound Name | methyl 4-methylsulfanyl-2-[3-(3-oxo-4H-quinoxalin-2-yl)propanoylamino]butanoate |
|---|---|
| PubChem CID | 163060626 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | methyl 4-methylsulfanyl-2-[3-(3-oxo-4H-quinoxalin-2-yl)propanoylamino]butanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)CCc1nc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C17H21N3O4S/c1-24-17(23)14(9-10-25-2)19-15(21)8-7-13-16(22)20-12-6-4-3-5-11(12)18-13/h3-6,14H,7-10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | VGINOMBSISPMGZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |