C31H38O8 — CID 163060663
[6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-5,15,15-trimethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] 2-methylbut-2-enoate (PubChem CID 163060663) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is [6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-5,15,15-trimethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] 2-methylbut-2-enoate.
| Compound Name | [6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-5,15,15-trimethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163060663 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-5,15,15-trimethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C2CC3=C4CC(=O)OC(c5ccoc5)C4(C)CCC3C(C2=O)C(CC(=O)OC)C1(C)C |
| InChI | InChI=1S/C31H38O8/c1-7-16(2)29(35)39-28-20-12-19-18(25(26(20)34)22(30(28,3)4)14-23(32)36-6)8-10-31(5)21(19)13-24(33)38-27(31)17-9-11-37-15-17/h7,9,11,15,18,20,22,25,27-28H,8,10,12-14H2,1-6H3 |
| InChIKey | XIFSDSRASWJFOZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|