C13H20O2 — CID 163061489
(1R,4R,4aS,8aR)-4-methyl-7-methylidene-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-1-carboxylic acid (PubChem CID 163061489) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,4R,4aS,8aR)-4-methyl-7-methylidene-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-1-carboxylic acid.
| Compound Name | (1R,4R,4aS,8aR)-4-methyl-7-methylidene-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 163061489 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,4R,4aS,8aR)-4-methyl-7-methylidene-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-1-carboxylic acid |
| SMILES | C=C1CC[C@@H]2[C@@H](C1)[C@H](C(=O)O)CC[C@H]2C |
| InChI | InChI=1S/C13H20O2/c1-8-3-5-10-9(2)4-6-11(13(14)15)12(10)7-8/h9-12H,1,3-7H2,2H3,(H,14,15)/t9-,10+,11-,12-/m1/s1 |
| InChIKey | OTSWLEWDCPYCGE-WRWGMCAJSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|