C13H24O6 — CID 163061695
(2R,3R,4S,5S,6R)-2-hept-3-enoxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163061695) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-hept-3-enoxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-hept-3-enoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163061695 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-hept-3-enoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCC=CCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O6/c1-2-3-4-5-6-7-18-13-12(17)11(16)10(15)9(8-14)19-13/h4-5,9-17H,2-3,6-8H2,1H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | IZUYBOMZSNVQJI-UJPOAAIJSA-N |
| XLogP | -0.45 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|