C20H31NO6 — CID 163061837
2-[[4-hydroxy-10-(hydroxymethyl)-6-methyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-3-yl]methylamino]-3-methylbutanoic acid (PubChem CID 163061837) has the molecular formula C20H31NO6 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-[[4-hydroxy-10-(hydroxymethyl)-6-methyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-3-yl]methylamino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-hydroxy-10-(hydroxymethyl)-6-methyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-3-yl]methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 163061837 |
| Molecular Formula | C20H31NO6 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[[4-hydroxy-10-(hydroxymethyl)-6-methyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-3-yl]methylamino]-3-methylbutanoic acid |
| SMILES | CC1=CCCC(CO)=CC2OC(=O)C(CNC(C(=O)O)C(C)C)C2C(O)C1 |
| InChI | InChI=1S/C20H31NO6/c1-11(2)18(19(24)25)21-9-14-17-15(23)7-12(3)5-4-6-13(10-22)8-16(17)27-20(14)26/h5,8,11,14-18,21-23H,4,6-7,9-10H2,1-3H3,(H,24,25) |
| InChIKey | UCOUTZSALUYAKJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|