About methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate
methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate (PubChem CID 163062008) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate |
| PubChem CID | 163062008 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate |
| SMILES | COC(=O)C[C@@]1(O)C=CC(=O)C[C@@H]1OC |
| InChI | InChI=1S/C10H14O5/c1-14-8-5-7(11)3-4-10(8,13)6-9(12)15-2/h3-4,8,13H,5-6H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | VQDHHHMWJHYEMS-WPRPVWTQSA-N |
| XLogP | -0.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate?
The IUPAC name of methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate (CID 163062008) is methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate.
What is the SMILES notation for methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate?
The canonical SMILES for methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate is COC(=O)C[C@@]1(O)C=CC(=O)C[C@@H]1OC.
What is the InChIKey of methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate?
The InChIKey is VQDHHHMWJHYEMS-WPRPVWTQSA-N. The full InChI is InChI=1S/C10H14O5/c1-14-8-5-7(11)3-4-10(8,13)6-9(12)15-2/h3-4,8,13H,5-6H2,1-2H3/t8-,10-/m0/s1.
What are the key properties of methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate?
methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate has a molecular weight of 214.22 g/mol, XLogP of -0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,6S)-1-hydroxy-6-methoxy-4-oxocyclohex-2-en-1-yl]acetate is sourced from PubChem (CID 163062008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).