C22H28O6 — CID 163062195
(4R,6S)-4-(4,5-dimethoxy-2-prop-2-enylphenoxy)-3,4-dimethoxy-6-prop-2-enylcyclohex-2-en-1-one (PubChem CID 163062195) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is (4R,6S)-4-(4,5-dimethoxy-2-prop-2-enylphenoxy)-3,4-dimethoxy-6-prop-2-enylcyclohex-2-en-1-one.
| Compound Name | (4R,6S)-4-(4,5-dimethoxy-2-prop-2-enylphenoxy)-3,4-dimethoxy-6-prop-2-enylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163062195 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (4R,6S)-4-(4,5-dimethoxy-2-prop-2-enylphenoxy)-3,4-dimethoxy-6-prop-2-enylcyclohex-2-en-1-one |
| SMILES | C=CCc1cc(OC)c(OC)cc1O[C@]1(OC)C[C@H](CC=C)C(=O)C=C1OC |
| InChI | InChI=1S/C22H28O6/c1-7-9-15-11-19(24-3)20(25-4)13-18(15)28-22(27-6)14-16(10-8-2)17(23)12-21(22)26-5/h7-8,11-13,16H,1-2,9-10,14H2,3-6H3/t16-,22+/m0/s1 |
| InChIKey | JYXLTLQGCJMUEX-KSFYIVLOSA-N |
| XLogP | 3.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|