C30H24O12 — CID 163062346
(1S,7R,8R,13R,21R)-7,13-bis(3,4-dihydroxyphenyl)-6,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),3,5(10),15,17,19-hexaene-3,8,17,19,21-pentol (PubChem CID 163062346) has the molecular formula C30H24O12 and a molecular weight of 576.51 g/mol. Its IUPAC name is (1S,7R,8R,13R,21R)-7,13-bis(3,4-dihydroxyphenyl)-6,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),3,5(10),15,17,19-hexaene-3,8,17,19,21-pentol.
| Compound Name | (1S,7R,8R,13R,21R)-7,13-bis(3,4-dihydroxyphenyl)-6,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),3,5(10),15,17,19-hexaene-3,8,17,19,21-pentol |
|---|---|
| PubChem CID | 163062346 |
| Molecular Formula | C30H24O12 |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | (1S,7R,8R,13R,21R)-7,13-bis(3,4-dihydroxyphenyl)-6,12,14-trioxapentacyclo[11.7.1.02,11.05,10.015,20]henicosa-2(11),3,5(10),15,17,19-hexaene-3,8,17,19,21-pentol |
| SMILES | Oc1cc(O)c2c(c1)O[C@]1(c3ccc(O)c(O)c3)Oc3c4c(cc(O)c3[C@H]2[C@H]1O)O[C@H](c1ccc(O)c(O)c1)[C@H](O)C4 |
| InChI | InChI=1S/C30H24O12/c31-13-7-19(36)24-23(8-13)41-30(12-2-4-16(33)18(35)6-12)29(39)26(24)25-20(37)10-22-14(28(25)42-30)9-21(38)27(40-22)11-1-3-15(32)17(34)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26+,27-,29-,30-/m1/s1 |
| InChIKey | SHYPVJZSIOEHJY-PLMPJQJCSA-N |
| XLogP | 2.79 |
| TPSA | 209.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|