C19H23N3O6 — CID 163062519
(2S,3R,4R,5R,6S)-2-[[2-[(Z)-hydroxyiminomethyl]-6-pyridin-2-yl-4-pyridinyl]oxy]-3,5-dimethoxy-6-methyloxan-4-ol (PubChem CID 163062519) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[[2-[(Z)-hydroxyiminomethyl]-6-pyridin-2-yl-4-pyridinyl]oxy]-3,5-dimethoxy-6-methyloxan-4-ol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[[2-[(Z)-hydroxyiminomethyl]-6-pyridin-2-yl-4-pyridinyl]oxy]-3,5-dimethoxy-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 163062519 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[[2-[(Z)-hydroxyiminomethyl]-6-pyridin-2-yl-4-pyridinyl]oxy]-3,5-dimethoxy-6-methyloxan-4-ol |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](OC)[C@H](Oc2cc(/C=N\O)nc(-c3ccccn3)c2)O[C@H]1C |
| InChI | InChI=1S/C19H23N3O6/c1-11-17(25-2)16(23)18(26-3)19(27-11)28-13-8-12(10-21-24)22-15(9-13)14-6-4-5-7-20-14/h4-11,16-19,23-24H,1-3H3/b21-10-/t11-,16+,17-,18+,19-/m0/s1 |
| InChIKey | POGOTIXPZKEDKH-NOXWKEDJSA-N |
| XLogP | 1.47 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|