C34H41N3O14 — CID 163062688
4-[6-[[3-[2-(3-ethylphenyl)ethoxy]-2,4-dihydroxy-5-methoxybenzoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-[[(N'-methylcarbamimidoyl)amino]methoxy]benzoic acid (PubChem CID 163062688) has the molecular formula C34H41N3O14 and a molecular weight of 715.71 g/mol. Its IUPAC name is 4-[6-[[3-[2-(3-ethylphenyl)ethoxy]-2,4-dihydroxy-5-methoxybenzoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-[[(N'-methylcarbamimidoyl)amino]methoxy]benzoic acid.
| Compound Name | 4-[6-[[3-[2-(3-ethylphenyl)ethoxy]-2,4-dihydroxy-5-methoxybenzoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-[[(N'-methylcarbamimidoyl)amino]methoxy]benzoic acid |
|---|---|
| PubChem CID | 163062688 |
| Molecular Formula | C34H41N3O14 |
| Molecular Weight | 715.71 g/mol |
| Exact Mass | 715.26 |
| IUPAC Name | 4-[6-[[3-[2-(3-ethylphenyl)ethoxy]-2,4-dihydroxy-5-methoxybenzoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-[[(N'-methylcarbamimidoyl)amino]methoxy]benzoic acid |
| SMILES | CCc1cccc(CCOc2c(O)c(OC)cc(C(=O)OCC3OC(Oc4ccc(C(=O)O)cc4OCN/C(N)=N/C)C(O)C(O)C3O)c2O)c1 |
| InChI | InChI=1S/C34H41N3O14/c1-4-17-6-5-7-18(12-17)10-11-47-30-25(38)20(14-23(46-3)27(30)40)32(45)48-15-24-26(39)28(41)29(42)33(51-24)50-21-9-8-19(31(43)44)13-22(21)49-16-37-34(35)36-2/h5-9,12-14,24,26,28-29,33,38-42H,4,10-11,15-16H2,1-3H3,(H,43,44)(H3,35,36,37) |
| InChIKey | HTPXNBPNCBBGCU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 261.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.71 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|