C28H44 — CID 163063340
17-(5,6-dimethylheptan-2-yl)-5,12-dimethyl-1,2,3,4,6,7,10,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 163063340) has the molecular formula C28H44 and a molecular weight of 380.66 g/mol. Its IUPAC name is 17-(5,6-dimethylheptan-2-yl)-5,12-dimethyl-1,2,3,4,6,7,10,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | 17-(5,6-dimethylheptan-2-yl)-5,12-dimethyl-1,2,3,4,6,7,10,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 163063340 |
| Molecular Formula | C28H44 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | 17-(5,6-dimethylheptan-2-yl)-5,12-dimethyl-1,2,3,4,6,7,10,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | Cc1cc2c(c3c1C(C(C)CCC(C)C(C)C)CC3)CCC1(C)CCCCC21 |
| InChI | InChI=1S/C28H44/c1-18(2)19(3)10-11-20(4)22-12-13-24-23-14-16-28(6)15-8-7-9-26(28)25(23)17-21(5)27(22)24/h17-20,22,26H,7-16H2,1-6H3 |
| InChIKey | RZLBBMDTYXMEEP-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |