C34H38N2O7 — CID 163063926
3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-3-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 163063926) has the molecular formula C34H38N2O7 and a molecular weight of 586.69 g/mol. Its IUPAC name is 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-3-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-3-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 163063926 |
| Molecular Formula | C34H38N2O7 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-3-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | COc1ccc(C(CC(=O)NCc2ccncc2)c2c(O)cc3c(c2O)C(=O)OC(C)CCCC(=O)CCCC=C3)cc1 |
| InChI | InChI=1S/C34H38N2O7/c1-22-7-6-10-26(37)9-5-3-4-8-25-19-29(38)32(33(40)31(25)34(41)43-22)28(24-11-13-27(42-2)14-12-24)20-30(39)36-21-23-15-17-35-18-16-23/h4,8,11-19,22,28,38,40H,3,5-7,9-10,20-21H2,1-2H3,(H,36,39) |
| InChIKey | CRLYLYKSNFLADZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |