C19H24O6 — CID 163064241
5-hydroxy-6-(methoxymethyl)-3a,5b-dimethyl-1,2,4,5,6,9,9a,10b-octahydro-as-indaceno[3,2-c]pyran-3,8,10-trione (PubChem CID 163064241) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-hydroxy-6-(methoxymethyl)-3a,5b-dimethyl-1,2,4,5,6,9,9a,10b-octahydro-as-indaceno[3,2-c]pyran-3,8,10-trione.
| Compound Name | 5-hydroxy-6-(methoxymethyl)-3a,5b-dimethyl-1,2,4,5,6,9,9a,10b-octahydro-as-indaceno[3,2-c]pyran-3,8,10-trione |
|---|---|
| PubChem CID | 163064241 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-hydroxy-6-(methoxymethyl)-3a,5b-dimethyl-1,2,4,5,6,9,9a,10b-octahydro-as-indaceno[3,2-c]pyran-3,8,10-trione |
| SMILES | COCC1OC(=O)CC2C(=O)C3=C(C(O)CC4(C)C(=O)CCC34)C12C |
| InChI | InChI=1S/C19H24O6/c1-18-7-11(20)16-15(9(18)4-5-12(18)21)17(23)10-6-14(22)25-13(8-24-3)19(10,16)2/h9-11,13,20H,4-8H2,1-3H3 |
| InChIKey | BMUNRNSPTWTXMH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |