C23H34O5 — CID 163064416
7-hydroxy-3a-methyl-1-[6-(2-oxopropoxy)heptan-2-yl]-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one (PubChem CID 163064416) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 7-hydroxy-3a-methyl-1-[6-(2-oxopropoxy)heptan-2-yl]-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one.
| Compound Name | 7-hydroxy-3a-methyl-1-[6-(2-oxopropoxy)heptan-2-yl]-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one |
|---|---|
| PubChem CID | 163064416 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 7-hydroxy-3a-methyl-1-[6-(2-oxopropoxy)heptan-2-yl]-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one |
| SMILES | CC(=O)COC(C)CCCC(C)C1=CCC2(C)OC3=C(CC12)C(=O)C(O)CC3 |
| InChI | InChI=1S/C23H34O5/c1-14(6-5-7-16(3)27-13-15(2)24)17-10-11-23(4)19(17)12-18-21(28-23)9-8-20(25)22(18)26/h10,14,16,19-20,25H,5-9,11-13H2,1-4H3 |
| InChIKey | JJJIYVRGEHVHMY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|