C28H35NO4 — CID 163064462
(1S,6S,8S,12R,15R,16R,17R)-17-benzyl-6-hydroxy-6,8,14,15-tetramethyl-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-triene-3,19-dione (PubChem CID 163064462) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is (1S,6S,8S,12R,15R,16R,17R)-17-benzyl-6-hydroxy-6,8,14,15-tetramethyl-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-triene-3,19-dione.
| Compound Name | (1S,6S,8S,12R,15R,16R,17R)-17-benzyl-6-hydroxy-6,8,14,15-tetramethyl-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-triene-3,19-dione |
|---|---|
| PubChem CID | 163064462 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | (1S,6S,8S,12R,15R,16R,17R)-17-benzyl-6-hydroxy-6,8,14,15-tetramethyl-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-triene-3,19-dione |
| SMILES | CC1=C[C@H]2C=CC[C@H](C)C[C@](C)(O)C=CC(=O)O[C@@]23C(=O)N[C@H](Cc2ccccc2)[C@H]3[C@H]1C |
| InChI | InChI=1S/C28H35NO4/c1-18-9-8-12-22-15-19(2)20(3)25-23(16-21-10-6-5-7-11-21)29-26(31)28(22,25)33-24(30)13-14-27(4,32)17-18/h5-8,10-15,18,20,22-23,25,32H,9,16-17H2,1-4H3,(H,29,31)/t18-,20-,22+,23+,25+,27+,28-/m0/s1 |
| InChIKey | PYGFBTSCVYWQCJ-HUENIDIDSA-N |
| XLogP | 4.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|