C8H13NO3 — CID 163064695
4-butyl-4-hydroxy-6-oxa-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 163064695) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-butyl-4-hydroxy-6-oxa-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | 4-butyl-4-hydroxy-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 163064695 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 4-butyl-4-hydroxy-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CCCCC1(O)NC(=O)C2OC21 |
| InChI | InChI=1S/C8H13NO3/c1-2-3-4-8(11)6-5(12-6)7(10)9-8/h5-6,11H,2-4H2,1H3,(H,9,10) |
| InChIKey | ABIFCFYADLKZLB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|