C21H32O2 — CID 163064817
methyl 2-[(1S,3E,7E,11E)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-enoate (PubChem CID 163064817) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is methyl 2-[(1S,3E,7E,11E)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-enoate.
| Compound Name | methyl 2-[(1S,3E,7E,11E)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 163064817 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | methyl 2-[(1S,3E,7E,11E)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C21H32O2/c1-16-8-6-10-17(2)12-14-20(19(4)21(22)23-5)15-13-18(3)11-7-9-16/h8,11-12,20H,4,6-7,9-10,13-15H2,1-3,5H3/b16-8+,17-12+,18-11+/t20-/m1/s1 |
| InChIKey | CCLHTOSXGFHKGP-NEUPFZBPSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|