C17H22O5 — CID 163064926
(2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatetracyclo[8.4.0.01,13.04,8]tetradecan-11-yl) acetate (PubChem CID 163064926) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatetracyclo[8.4.0.01,13.04,8]tetradecan-11-yl) acetate.
| Compound Name | (2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatetracyclo[8.4.0.01,13.04,8]tetradecan-11-yl) acetate |
|---|---|
| PubChem CID | 163064926 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatetracyclo[8.4.0.01,13.04,8]tetradecan-11-yl) acetate |
| SMILES | C=C1C(=O)OC2CC(C)C34OC3CC(C)(OC(C)=O)C4CC12 |
| InChI | InChI=1S/C17H22O5/c1-8-5-12-11(9(2)15(19)20-12)6-13-16(4,21-10(3)18)7-14-17(8,13)22-14/h8,11-14H,2,5-7H2,1,3-4H3 |
| InChIKey | VZQONDVAHRYHCF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|