C18H30O6 — CID 163064954
2-hexyl-9,10,12a-trihydroxy-2,3,4,4a,7,8,9,10-octahydropyrano[3,2-b]oxecin-6-one (PubChem CID 163064954) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-hexyl-9,10,12a-trihydroxy-2,3,4,4a,7,8,9,10-octahydropyrano[3,2-b]oxecin-6-one.
| Compound Name | 2-hexyl-9,10,12a-trihydroxy-2,3,4,4a,7,8,9,10-octahydropyrano[3,2-b]oxecin-6-one |
|---|---|
| PubChem CID | 163064954 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-hexyl-9,10,12a-trihydroxy-2,3,4,4a,7,8,9,10-octahydropyrano[3,2-b]oxecin-6-one |
| SMILES | CCCCCCC1CCC2OC(=O)CCC(O)C(O)C=CC2(O)O1 |
| InChI | InChI=1S/C18H30O6/c1-2-3-4-5-6-13-7-9-16-18(22,24-13)12-11-15(20)14(19)8-10-17(21)23-16/h11-16,19-20,22H,2-10H2,1H3 |
| InChIKey | SUTLNXDRSYQRIT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|