C14H18O5 — CID 163065165
4,4,14-trimethyl-11-methylidene-3,5,9,12-tetraoxatetracyclo[6.5.1.01,10.02,6]tetradecan-13-one (PubChem CID 163065165) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 4,4,14-trimethyl-11-methylidene-3,5,9,12-tetraoxatetracyclo[6.5.1.01,10.02,6]tetradecan-13-one.
| Compound Name | 4,4,14-trimethyl-11-methylidene-3,5,9,12-tetraoxatetracyclo[6.5.1.01,10.02,6]tetradecan-13-one |
|---|---|
| PubChem CID | 163065165 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4,4,14-trimethyl-11-methylidene-3,5,9,12-tetraoxatetracyclo[6.5.1.01,10.02,6]tetradecan-13-one |
| SMILES | C=C1OC(=O)C23C1OC(CC1OC(C)(C)OC12)C3C |
| InChI | InChI=1S/C14H18O5/c1-6-8-5-9-11(19-13(3,4)18-9)14(6)10(17-8)7(2)16-12(14)15/h6,8-11H,2,5H2,1,3-4H3 |
| InChIKey | DCWNOEXTQMVXFZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |