C12H19NO — CID 163065256
6,8-dimethyldeca-2,4,6-trienamide (PubChem CID 163065256) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 6,8-dimethyldeca-2,4,6-trienamide.
| Compound Name | 6,8-dimethyldeca-2,4,6-trienamide |
|---|---|
| PubChem CID | 163065256 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 6,8-dimethyldeca-2,4,6-trienamide |
| SMILES | CCC(C)C=C(C)C=CC=CC(N)=O |
| InChI | InChI=1S/C12H19NO/c1-4-10(2)9-11(3)7-5-6-8-12(13)14/h5-10H,4H2,1-3H3,(H2,13,14) |
| InChIKey | SVYJJKONBNGLHF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|