C44H74O13 — CID 163065701
[17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,10,14-pentamethyl-2,11-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 163065701) has the molecular formula C44H74O13 and a molecular weight of 811.06 g/mol. Its IUPAC name is [17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,10,14-pentamethyl-2,11-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,10,14-pentamethyl-2,11-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 163065701 |
| Molecular Formula | C44H74O13 |
| Molecular Weight | 811.06 g/mol |
| Exact Mass | 810.51 |
| IUPAC Name | [17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,10,14-pentamethyl-2,11-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC2OC(C)C(O)C(O)C2O)CC2(C)C(CCC3(C)C2C(OC2OC(C)C(O)C(O)C2O)CC2C(C(C)(O)CCC=C(C)C)CCC23C)C1(C)C |
| InChI | InChI=1S/C44H74O13/c1-21(2)13-12-16-44(11,52)25-14-17-42(9)26(25)19-27(56-38-34(50)32(48)30(46)22(3)53-38)36-41(8)20-28(57-39-35(51)33(49)31(47)23(4)54-39)37(55-24(5)45)40(6,7)29(41)15-18-43(36,42)10/h13,22-23,25-39,46-52H,12,14-20H2,1-11H3 |
| InChIKey | ZYRMYMFFWQEZGI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.06 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|