C26H36O3 — CID 163065927
7-[2-(3-butan-2-yl-2-methyloxiran-2-yl)-3,6-dimethyl-1,2,4a,5,8,8a-hexahydronaphthalen-1-yl]hepta-2,4,6-trienoic acid (PubChem CID 163065927) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is 7-[2-(3-butan-2-yl-2-methyloxiran-2-yl)-3,6-dimethyl-1,2,4a,5,8,8a-hexahydronaphthalen-1-yl]hepta-2,4,6-trienoic acid.
| Compound Name | 7-[2-(3-butan-2-yl-2-methyloxiran-2-yl)-3,6-dimethyl-1,2,4a,5,8,8a-hexahydronaphthalen-1-yl]hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 163065927 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 7-[2-(3-butan-2-yl-2-methyloxiran-2-yl)-3,6-dimethyl-1,2,4a,5,8,8a-hexahydronaphthalen-1-yl]hepta-2,4,6-trienoic acid |
| SMILES | CCC(C)C1OC1(C)C1C(C)=CC2CC(C)=CCC2C1C=CC=CC=CC(=O)O |
| InChI | InChI=1S/C26H36O3/c1-6-18(3)25-26(5,29-25)24-19(4)16-20-15-17(2)13-14-21(20)22(24)11-9-7-8-10-12-23(27)28/h7-13,16,18,20-22,24-25H,6,14-15H2,1-5H3,(H,27,28) |
| InChIKey | GEGSNPGPRRSEET-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|