C36H66O9Si — CID 163066834
methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[5-[4-[5-(1-ethoxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-methyl-3-oxopent-1-enyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-methylpentanoate (PubChem CID 163066834) has the molecular formula C36H66O9Si and a molecular weight of 671.00 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[5-[4-[5-(1-ethoxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-methyl-3-oxopent-1-enyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-methylpentanoate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[5-[4-[5-(1-ethoxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-methyl-3-oxopent-1-enyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-methylpentanoate |
|---|---|
| PubChem CID | 163066834 |
| Molecular Formula | C36H66O9Si |
| Molecular Weight | 671.00 g/mol |
| Exact Mass | 670.45 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[5-[4-[5-(1-ethoxypropyl)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-methyl-3-oxopent-1-enyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-methylpentanoate |
| SMILES | CCOC(CC)C1(C)OC(C)(C)OC1C(C)C(=O)C(C)=CC1(C)OC(C)(C)OC1C(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(=O)OC |
| InChI | InChI=1S/C36H66O9Si/c1-19-26(40-20-2)36(15)30(42-34(12,13)45-36)23(4)27(37)22(3)21-35(14)29(41-33(10,11)44-35)24(5)28(25(6)31(38)39-16)43-46(17,18)32(7,8)9/h21,23-26,28-30H,19-20H2,1-18H3 |
| InChIKey | ZSXOESDFZFOLOC-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.00 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|