C32H52O4 — CID 163067185
methyl 1,10-dihydroxy-1,2,2,6a,6b,9,9,12a-octamethyl-4,5,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-3H-picene-4a-carboxylate (PubChem CID 163067185) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is methyl 1,10-dihydroxy-1,2,2,6a,6b,9,9,12a-octamethyl-4,5,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-3H-picene-4a-carboxylate.
| Compound Name | methyl 1,10-dihydroxy-1,2,2,6a,6b,9,9,12a-octamethyl-4,5,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-3H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 163067185 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | methyl 1,10-dihydroxy-1,2,2,6a,6b,9,9,12a-octamethyl-4,5,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-3H-picene-4a-carboxylate |
| SMILES | COC(=O)C12CCC(C)(C)C(C)(O)C1C1=CCC3C4(C)CCC(O)C(C)(C)C4CCC3(C)C1(C)CC2 |
| InChI | InChI=1S/C32H52O4/c1-26(2)16-18-32(25(34)36-9)19-17-29(6)20(24(32)31(26,8)35)10-11-22-28(5)14-13-23(33)27(3,4)21(28)12-15-30(22,29)7/h10,21-24,33,35H,11-19H2,1-9H3 |
| InChIKey | RPUDXNRQMHOPRI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|