C20H30O3 — CID 163067590
[(1aR,4R,7R,7aR,7bS)-1,1,7,7a-tetramethyl-2-oxo-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-4-yl] (2R)-2-methylbutanoate (PubChem CID 163067590) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is [(1aR,4R,7R,7aR,7bS)-1,1,7,7a-tetramethyl-2-oxo-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-4-yl] (2R)-2-methylbutanoate.
| Compound Name | [(1aR,4R,7R,7aR,7bS)-1,1,7,7a-tetramethyl-2-oxo-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-4-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 163067590 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [(1aR,4R,7R,7aR,7bS)-1,1,7,7a-tetramethyl-2-oxo-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-4-yl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@@H]1CC[C@@H](C)[C@@]2(C)C1=CC(=O)[C@@H]1[C@H]2C1(C)C |
| InChI | InChI=1S/C20H30O3/c1-7-11(2)18(22)23-15-9-8-12(3)20(6)13(15)10-14(21)16-17(20)19(16,4)5/h10-12,15-17H,7-9H2,1-6H3/t11-,12-,15-,16-,17+,20+/m1/s1 |
| InChIKey | GJIZSYSMPFMNED-CKTIHQIMSA-N |
| XLogP | 4.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |