C22H38O3 — CID 163067793
methyl 5-(2-methoxy-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl)-3-methylpentanoate (PubChem CID 163067793) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is methyl 5-(2-methoxy-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl)-3-methylpentanoate.
| Compound Name | methyl 5-(2-methoxy-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 163067793 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | methyl 5-(2-methoxy-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl)-3-methylpentanoate |
| SMILES | COC(=O)CC(C)CCC1C(C)(OC)C=CC2C(C)(C)CCCC21C |
| InChI | InChI=1S/C22H38O3/c1-16(15-19(23)24-6)9-10-18-21(4)13-8-12-20(2,3)17(21)11-14-22(18,5)25-7/h11,14,16-18H,8-10,12-13,15H2,1-7H3 |
| InChIKey | GLCPAKRBJQFMMZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|